Systematic / IUPAC Name: 5-[(2S)-1-(Furan-2-ylmethyl)pyrrolidin-2-yl]-3-[4-(2-methoxyethoxy)pyridin-2-yl]-1,2,4-oxadiazole
ID: Reference10614
Other Names: NAT18-431444
Formula: C19H22N4O4
2-{5-[(2S)-1-(2-Furylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-4-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 315 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/2/2021 6:38:52 AM |
| InChI | InChI=1S/C19H22N4O4/c1-24-10-11-26-14-6-7-20-16(12-14)18-21-19(27-22-18)17-5-2-8-23(17)13-15-4-3-9-25-15/h3-4,6-7,9,12,17H,2,5,8,10-11,13H2,1H3/t17-/m0/s1 |
| InChI Key | DBLATLOKZLDRKN-KRWDZBQOSA-N |
| Canonical SMILES | COCCOC1=CC(=NC=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names | NAT18-431444 |