Systematic / IUPAC Name: 5-[(2S)-1-(1H-Indol-3-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-4-yl]-1,2,4-oxadiazole
ID: Reference10616
Other Names: NAT18-429053
Formula: C23H25N5O3
3-{[(2S)-2-{3-[2-(2-Methoxyethoxy)-4-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2096 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/2/2021 6:43:30 AM |
| InChI | InChI=1S/C23H25N5O3/c1-29-11-12-30-21-13-16(8-9-24-21)22-26-23(31-27-22)20-7-4-10-28(20)15-17-14-25-19-6-3-2-5-18(17)19/h2-3,5-6,8-9,13-14,20,25H,4,7,10-12,15H2,1H3/t20-/m0/s1 |
| InChI Key | DYZSRFGOEFOUNS-FQEVSTJZSA-N |
| Canonical SMILES | COCCOC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=CNC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | NAT18-429053 |