Systematic / IUPAC Name: 1-Ethyl-3-[[(1S,4S,6S)-3-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]urea
ID: Reference10621
Other Names:
Urea, N-ethyl-N'-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-;
NAT28-405021
Formula: C21H38N4O2
1-Ethyl-3-({(1S,4S,6S)-6-isopropyl-3-methyl-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl}methyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1050 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/2/2021 7:13:09 AM |
| InChI | InChI=1S/C21H38N4O2/c1-6-22-21(27)23-14-18-11-16(4)17(12-19(18)15(2)3)13-20(26)25-9-7-24(5)8-10-25/h11,15,17-19H,6-10,12-14H2,1-5H3,(H2,22,23,27)/t17-,18-,19-/m0/s1 |
| InChI Key | PNSAWJFEOWROMW-FHWLQOOXSA-N |
| Canonical SMILES | CCNC(=O)NCC1C=C(C(CC1C(C)C)CC(=O)N2CCN(CC2)C)C |
| CAS | |
| Splash | |
| Other Names |
Urea, N-ethyl-N'-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-; NAT28-405021 |