Systematic / IUPAC Name: 2-Methyl-5-[[(1S,4S,5S)-2-methyl-5-propan-2-yl-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]cyclohex-2-en-1-yl]methyl]-1,3,4-oxadiazole
ID: Reference10629
Other Names: NAT28-410271
Formula: C23H34N6O
2-[4-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)-1-piperazinyl]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1225 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/2/2021 7:30:15 AM |
| InChI | InChI=1S/C23H34N6O/c1-16(2)21-13-19(14-22-27-26-18(4)30-22)17(3)12-20(21)15-28-8-10-29(11-9-28)23-24-6-5-7-25-23/h5-7,12,16,19-21H,8-11,13-15H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChI Key | CDOKAGJGWGLMRW-ACRUOGEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C)C(C)C)CN3CCN(CC3)C4=NC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT28-410271 |