Systematic / IUPAC Name: 5-[(2S)-1-Benzylpyrrolidin-2-yl]-3-[6-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazole
ID: Reference10633
Other Names: NAT18-432626
Formula: C21H24N4O3
5-{5-[(2S)-1-Benzyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 563 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 10:11:29 AM |
| InChI | InChI=1S/C21H24N4O3/c1-26-12-13-27-19-10-9-17(14-22-19)20-23-21(28-24-20)18-8-5-11-25(18)15-16-6-3-2-4-7-16/h2-4,6-7,9-10,14,18H,5,8,11-13,15H2,1H3/t18-/m0/s1 |
| InChI Key | MACAVIYZAFUHKT-SFHVURJKSA-N |
| Canonical SMILES | COCCOC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT18-432626 |