Systematic / IUPAC Name: N-[4-[[(2S)-2-[3-[6-(2-Methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenyl]acetamide
ID: Reference10634
Other Names: NAT18-432666
Formula: C23H27N5O4
N-(4-{[(2S)-2-{3-[6-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}phenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3711 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 10:27:58 AM |
| InChI | InChI=1S/C23H27N5O4/c1-16(29)25-19-8-5-17(6-9-19)15-28-11-3-4-20(28)23-26-22(27-32-23)18-7-10-21(24-14-18)31-13-12-30-2/h5-10,14,20H,3-4,11-13,15H2,1-2H3,(H,25,29)/t20-/m0/s1 |
| InChI Key | FXJSIDOYMOXRRA-FQEVSTJZSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-432666 |