Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-4-yl]-5-[(2S)-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10642
Other Names: NAT18-429058
Formula: C20H29N5O3
2-(2-Methoxyethoxy)-4-{5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 619 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 10:50:56 AM |
| InChI | InChI=1S/C20H29N5O3/c1-24-10-6-16(7-11-24)25-9-3-4-17(25)20-22-19(23-28-20)15-5-8-21-18(14-15)27-13-12-26-2/h5,8,14,16-17H,3-4,6-7,9-13H2,1-2H3/t17-/m0/s1 |
| InChI Key | YLZXIQYSPMWZBQ-KRWDZBQOSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=CC(=NC=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-429058 |