Systematic / IUPAC Name: [1-[[(1S,4S,6S)-3-Methyl-6-propan-2-yl-4-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]cyclohex-2-en-1-yl]methyl]piperidin-4-yl]methanol
ID: Reference10644
Other Names: NAT28-413015
Formula: C23H39N3O2
[1-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)-4-piperidinyl]methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 970 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 9:00:06 AM |
| InChI | InChI=1S/C23H39N3O2/c1-5-6-22-24-25-23(28-22)13-19-12-21(16(2)3)20(11-17(19)4)14-26-9-7-18(15-27)8-10-26/h11,16,18-21,27H,5-10,12-15H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChI Key | DMVPGXOGNGSCGU-ACRUOGEOSA-N |
| Canonical SMILES | CCCC1=NN=C(O1)CC2CC(C(C=C2C)CN3CCC(CC3)CO)C(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-413015 |