Systematic / IUPAC Name: 2-[[(1S,4S,5S)-4-[[4-(2-Methoxyethyl)piperazin-1-yl]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-5-methyl-1,3,4-oxadiazole
ID: Reference10649
Other Names: NAT28-410308
Formula: C22H38N4O2
1-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)-4-(2-methoxyethyl)piperazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1120 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 9:40:59 AM |
| InChI | InChI=1S/C22H38N4O2/c1-16(2)21-13-19(14-22-24-23-18(4)28-22)17(3)12-20(21)15-26-8-6-25(7-9-26)10-11-27-5/h12,16,19-21H,6-11,13-15H2,1-5H3/t19-,20-,21-/m0/s1 |
| InChI Key | OHNSINRVMNRNCQ-ACRUOGEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C)C(C)C)CN3CCN(CC3)CCOC |
| CAS | |
| Splash | |
| Other Names | NAT28-410308 |