Systematic / IUPAC Name: 1-[4-[(2S)-2-[3-[2-(2-Methoxyethylamino)pyridin-4-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10650
Other Names: NAT18-428634
Formula: C21H30N6O3
1-{4-[(2S)-2-(3-{2-[(2-Methoxyethyl)amino]-4-pyridinyl}-1,2,4-oxadiazol-5-yl)-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 9:42:08 AM |
| InChI | InChI=1S/C21H30N6O3/c1-15(28)26-11-6-17(7-12-26)27-10-3-4-18(27)21-24-20(25-30-21)16-5-8-22-19(14-16)23-9-13-29-2/h5,8,14,17-18H,3-4,6-7,9-13H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChI Key | ZFHAIHNYLWLIFJ-SFHVURJKSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=CC(=NC=C4)NCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-428634 |