Systematic / IUPAC Name: 4-[5-[(2S)-1-[(2-Fluorophenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N-(2-methoxyethyl)pyridin-2-amine
ID: Reference10652
Other Names: NAT18-428648
Formula: C21H24FN5O2
4-{5-[(2S)-1-(2-Fluorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N-(2-methoxyethyl)-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 995 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/9/2021 9:49:36 AM |
| InChI | InChI=1S/C21H24FN5O2/c1-28-12-10-24-19-13-15(8-9-23-19)20-25-21(29-26-20)18-7-4-11-27(18)14-16-5-2-3-6-17(16)22/h2-3,5-6,8-9,13,18H,4,7,10-12,14H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChI Key | GPPMPMDDRJBSCP-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4F |
| CAS | |
| Splash | |
| Other Names | NAT18-428648 |