Systematic / IUPAC Name: N-[4-[[(2S)-2-[3-(6-Morpholin-4-ylpyridin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenyl]acetamide
ID: Reference10660
Other Names: NAT18-432381
Formula: C24H28N6O3
N-(4-{[(2S)-2-{3-[6-(4-Morpholinyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}phenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1840 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2021 12:02:56 PM |
| InChI | InChI=1S/C24H28N6O3/c1-17(31)26-20-7-4-18(5-8-20)16-30-10-2-3-21(30)24-27-23(28-33-24)19-6-9-22(25-15-19)29-11-13-32-14-12-29/h4-9,15,21H,2-3,10-14,16H2,1H3,(H,26,31)/t21-/m0/s1 |
| InChI Key | VGDYGNOMODUKOI-NRFANRHFSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)N5CCOCC5 |
| CAS | |
| Splash | |
| Other Names | NAT18-432381 |