Systematic / IUPAC Name: N-(2-Methoxyethyl)-4-[5-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10662
Other Names: NAT18-428655
Formula: C18H27N5O2
4-{5-[(2S)-1-Isobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N-(2-methoxyethyl)-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1060 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2021 12:05:05 PM |
| InChI | InChI=1S/C18H27N5O2/c1-13(2)12-23-9-4-5-15(23)18-21-17(22-25-18)14-6-7-19-16(11-14)20-8-10-24-3/h6-7,11,13,15H,4-5,8-10,12H2,1-3H3,(H,19,20)/t15-/m0/s1 |
| InChI Key | FYMVXZAURPHIGA-HNNXBMFYSA-N |
| Canonical SMILES | CC(C)CN1CCCC1C2=NC(=NO2)C3=CC(=NC=C3)NCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-428655 |