Systematic / IUPAC Name: 4-[5-[5-[(2S)-1-[(2-Methoxyphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]morpholine
ID: Reference10663
Other Names: NAT18-432362
Formula: C23H27N5O3
4-(5-{5-[(2S)-1-(2-Methoxybenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinyl)morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2135 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2021 12:06:15 PM |
| InChI | InChI=1S/C23H27N5O3/c1-29-20-7-3-2-5-18(20)16-28-10-4-6-19(28)23-25-22(26-31-23)17-8-9-21(24-15-17)27-11-13-30-14-12-27/h2-3,5,7-9,15,19H,4,6,10-14,16H2,1H3/t19-/m0/s1 |
| InChI Key | ZCWLCTIDZFXYQA-IBGZPJMESA-N |
| Canonical SMILES | COC1=CC=CC=C1CN2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)N5CCOCC5 |
| CAS | |
| Splash | |
| Other Names | NAT18-432362 |