Systematic / IUPAC Name: N-(2-Methoxyethyl)-4-[5-[(2S)-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10664
Other Names: NAT18-428659
Formula: C20H30N6O2
N-(2-Methoxyethyl)-4-{5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 505 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2021 12:07:12 PM |
| InChI | InChI=1S/C20H30N6O2/c1-25-11-6-16(7-12-25)26-10-3-4-17(26)20-23-19(24-28-20)15-5-8-21-18(14-15)22-9-13-27-2/h5,8,14,16-17H,3-4,6-7,9-13H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChI Key | OAOZUSWVFGTHSP-KRWDZBQOSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=CC(=NC=C4)NCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-428659 |