Systematic / IUPAC Name: 5-[(2S)-1-(1H-Imidazol-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-4-yl]-1,2,4-oxadiazole
ID: Reference10669
Other Names: NAT18-429078
Formula: C18H22N6O3
4-{5-[(2S)-1-(1H-Imidazol-2-ylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1996 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2021 12:14:36 PM |
| InChI | InChI=1S/C18H22N6O3/c1-25-9-10-26-16-11-13(4-5-21-16)17-22-18(27-23-17)14-3-2-8-24(14)12-15-19-6-7-20-15/h4-7,11,14H,2-3,8-10,12H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChI Key | GCOOAZRHWCWMKI-AWEZNQCLSA-N |
| Canonical SMILES | COCCOC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=NC=CN4 |
| CAS | |
| Splash | |
| Other Names | NAT18-429078 |