Systematic / IUPAC Name: 3-[4-(2-Methoxyethoxy)pyridin-2-yl]-5-[(2S)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10679
Other Names: NAT18-431467
Formula: C24H30N4O6
4-(2-Methoxyethoxy)-2-{5-[(2S)-1-(3,4,5-trimethoxybenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1317 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 8:32:01 AM |
| InChI | InChI=1S/C24H30N4O6/c1-29-10-11-33-17-7-8-25-18(14-17)23-26-24(34-27-23)19-6-5-9-28(19)15-16-12-20(30-2)22(32-4)21(13-16)31-3/h7-8,12-14,19H,5-6,9-11,15H2,1-4H3/t19-/m0/s1 |
| InChI Key | SPUJAPJHHWROEU-IBGZPJMESA-N |
| Canonical SMILES | COCCOC1=CC(=NC=C1)C2=NOC(=N2)C3CCCN3CC4=CC(=C(C(=C4)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names | NAT18-431467 |