Systematic / IUPAC Name: 4-[[(2S)-2-[3-[2-(2-Methoxyethoxy)pyridin-4-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]benzonitrile
ID: Reference10681
Other Names: NAT18-429042
Formula: C22H23N5O3
4-{[(2S)-2-{3-[2-(2-Methoxyethoxy)-4-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1704 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 8:46:48 AM |
| InChI | InChI=1S/C22H23N5O3/c1-28-11-12-29-20-13-18(8-9-24-20)21-25-22(30-26-21)19-3-2-10-27(19)15-17-6-4-16(14-23)5-7-17/h4-9,13,19H,2-3,10-12,15H2,1H3/t19-/m0/s1 |
| InChI Key | JFHLZGBZYMQDOG-IBGZPJMESA-N |
| Canonical SMILES | COCCOC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=CC=C(C=C4)C#N |
| CAS | |
| Splash | |
| Other Names | NAT18-429042 |