Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-4-yl]-5-[(2S)-1-propylpyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10682
Other Names: NAT18-429063
Formula: C17H24N4O3
2-(2-Methoxyethoxy)-4-{5-[(2S)-1-propyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 8:48:50 AM |
| InChI | InChI=1S/C17H24N4O3/c1-3-8-21-9-4-5-14(21)17-19-16(20-24-17)13-6-7-18-15(12-13)23-11-10-22-2/h6-7,12,14H,3-5,8-11H2,1-2H3/t14-/m0/s1 |
| InChI Key | MELZJDXHESHMIG-AWEZNQCLSA-N |
| Canonical SMILES | CCCN1CCCC1C2=NC(=NO2)C3=CC(=NC=C3)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-429063 |