Systematic / IUPAC Name: 3-[4-(2-Methoxyethoxy)pyridin-2-yl]-5-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10684
Other Names: NAT18-431448
Formula: C18H26N4O3
2-{5-[(2S)-1-Isobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-4-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 305 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 8:52:40 AM |
| InChI | InChI=1S/C18H26N4O3/c1-13(2)12-22-8-4-5-16(22)18-20-17(21-25-18)15-11-14(6-7-19-15)24-10-9-23-3/h6-7,11,13,16H,4-5,8-10,12H2,1-3H3/t16-/m0/s1 |
| InChI Key | IRMUAXNXODOANM-INIZCTEOSA-N |
| Canonical SMILES | CC(C)CN1CCCC1C2=NC(=NO2)C3=NC=CC(=C3)OCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-431448 |
| PubChem | 45783445 |
| ChemSpider | 29857848 |
| ChEMBL | CHEMBL3436892 |