Systematic / IUPAC Name: 5-[(2S)-1-[(3,4-Difluorophenyl)methyl]pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-4-yl]-1,2,4-oxadiazole
ID: Reference10686
Other Names: NAT18-429045
Formula: C21H22F2N4O3
4-{5-[(2S)-1-(3,4-Difluorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 695 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 9:00:25 AM |
| InChI | InChI=1S/C21H22F2N4O3/c1-28-9-10-29-19-12-15(6-7-24-19)20-25-21(30-26-20)18-3-2-8-27(18)13-14-4-5-16(22)17(23)11-14/h4-7,11-12,18H,2-3,8-10,13H2,1H3/t18-/m0/s1 |
| InChI Key | KMDWQXQYCAXNKU-SFHVURJKSA-N |
| Canonical SMILES | COCCOC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=CC(=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names | NAT18-429045 |