Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-4-yl]-5-[(2S)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10687
Other Names: NAT18-429065
Formula: C20H23N5O3
2-(2-Methoxyethoxy)-4-{5-[(2S)-1-(3-pyridinylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 590 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 9:25:44 AM |
| InChI | InChI=1S/C20H23N5O3/c1-26-10-11-27-18-12-16(6-8-22-18)19-23-20(28-24-19)17-5-3-9-25(17)14-15-4-2-7-21-13-15/h2,4,6-8,12-13,17H,3,5,9-11,14H2,1H3/t17-/m0/s1 |
| InChI Key | YZFRVBBUFRPNBY-KRWDZBQOSA-N |
| Canonical SMILES | COCCOC1=NC=CC(=C1)C2=NOC(=N2)C3CCCN3CC4=CN=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT18-429065 |