Systematic / IUPAC Name: 5-Methoxy-2-[[(2S)-2-[3-[6-(2-methoxyethylamino)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenol
ID: Reference10691
Other Names: NAT18-432274
Formula: C22H27N5O4
5-Methoxy-2-{[(2S)-2-(3-{6-[(2-methoxyethyl)amino]-3-pyridinyl}-1,2,4-oxadiazol-5-yl)-1-pyrrolidinyl]methyl}phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 940 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 9:32:17 AM |
| InChI | InChI=1S/C22H27N5O4/c1-29-11-9-23-20-8-6-15(13-24-20)21-25-22(31-26-21)18-4-3-10-27(18)14-16-5-7-17(30-2)12-19(16)28/h5-8,12-13,18,28H,3-4,9-11,14H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChI Key | FVCJHOXHNLUPLZ-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=C(C=C(C=C4)OC)O |
| CAS | |
| Splash | |
| Other Names | NAT18-432274 |