Systematic / IUPAC Name: N-(2-Methoxyethyl)-5-[5-[(2S)-1-pyrimidin-2-ylpyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10693
Other Names: NAT18-468378
Formula: C18H21N7O2
N-(2-Methoxyethyl)-5-{5-[(2S)-1-(2-pyrimidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1475 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2021 9:34:34 AM |
| InChI | InChI=1S/C18H21N7O2/c1-26-11-9-19-15-6-5-13(12-22-15)16-23-17(27-24-16)14-4-2-10-25(14)18-20-7-3-8-21-18/h3,5-8,12,14H,2,4,9-11H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChI Key | JBTVRRKINOVBGE-AWEZNQCLSA-N |
| Canonical SMILES | COCCNC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3C4=NC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT18-468378 |