Systematic / IUPAC Name: 3-[2-(2-Methoxyethoxy)pyridin-3-yl]-5-[(2S)-1-pyrimidin-2-ylpyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10699
Other Names: NAT18-468414
Formula: C18H20N6O3
2-[(2S)-2-{3-[2-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 474 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 2:10:08 PM |
| InChI | InChI=1S/C18H20N6O3/c1-25-11-12-26-16-13(5-2-7-19-16)15-22-17(27-23-15)14-6-3-10-24(14)18-20-8-4-9-21-18/h2,4-5,7-9,14H,3,6,10-12H2,1H3/t14-/m0/s1 |
| InChI Key | TXBUNLPPORYESW-AWEZNQCLSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3C4=NC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT18-468414 |