Systematic / IUPAC Name: 3-[4-(2-Methoxyethoxy)pyridin-2-yl]-5-[(2S)-1-(1-methylpiperidin-4-yl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10702
Other Names:
Pyridine, 4-(2-methoxyethoxy)-2-[5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-;
NAT18-431452
Formula: C20H29N5O3
4-(2-Methoxyethoxy)-2-{5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 653 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 2:22:03 PM |
| InChI | InChI=1S/C20H29N5O3/c1-24-10-6-15(7-11-24)25-9-3-4-18(25)20-22-19(23-28-20)17-14-16(5-8-21-17)27-13-12-26-2/h5,8,14-15,18H,3-4,6-7,9-13H2,1-2H3/t18-/m0/s1 |
| InChI Key | CDKYRFZKAUKNLH-SFHVURJKSA-N |
| Canonical SMILES | CN1CCC(CC1)N2CCCC2C3=NC(=NO3)C4=NC=CC(=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 4-(2-methoxyethoxy)-2-[5-[(2S)-1-(1-methyl-4-piperidinyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-; NAT18-431452 |