Systematic / IUPAC Name: 2-[(3R,4S)-1-(Cyclopropanecarbonyl)-3-ethylpiperidin-4-yl]-N-cyclopropylacetamide
ID: Reference10707
Other Names: NAT14-316346
Formula: C16H26N2O2
N-Cyclopropyl-2-[(3R,4S)-1-(cyclopropylcarbonyl)-3-ethyl-4-piperidinyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1193 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 2:41:30 PM |
| InChI | InChI=1S/C16H26N2O2/c1-2-11-10-18(16(20)12-3-4-12)8-7-13(11)9-15(19)17-14-5-6-14/h11-14H,2-10H2,1H3,(H,17,19)/t11-,13-/m0/s1 |
| InChI Key | XVMUWCILZTWHCE-AAEUAGOBSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)NC2CC2)C(=O)C3CC3 |
| CAS | |
| Splash | |
| Other Names | NAT14-316346 |