Systematic / IUPAC Name: 3-[5-[(2S)-1-[(3,4-Difluorophenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N-(2-methoxyethyl)pyridin-2-amine
ID: Reference10708
Other Names: NAT18-429843
Formula: C21H23F2N5O2
3-{5-[(2S)-1-(3,4-Difluorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N-(2-methoxyethyl)-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1832 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 2:43:49 PM |
| InChI | InChI=1S/C21H23F2N5O2/c1-29-11-9-25-19-15(4-2-8-24-19)20-26-21(30-27-20)18-5-3-10-28(18)13-14-6-7-16(22)17(23)12-14/h2,4,6-8,12,18H,3,5,9-11,13H2,1H3,(H,24,25)/t18-/m0/s1 |
| InChI Key | GMAGFWOMKOHHMY-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC(=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names | NAT18-429843 |