Systematic / IUPAC Name: N'-(3,5-Dimethylbenzoyl)-3-methoxy-2-methyl-N'-(2-methyl-2-propanyl)benzohydrazide
ID: Reference1071
Other Names:
Benzoic acid, 3-methoxy-2-methyl, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide;
3-Methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide;
N'-(tert-Butyl )-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide
Formula: C22H28N2O3
Class: Pesticides/Herbicides
Methoxyfenozide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 4008 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/11/2014 3:21:59 PM |
| InChI | InChI=1S/C22H28N2O3/c1-14-11-15(2)13-17(12-14)21(26)24(22(4,5)6)23-20(25)18-9-8-10-19(27-7)16(18)3/h8-13H,1-7H3,(H,23,25) |
| InChI Key | QCAWEPFNJXQPAN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C(=CC=C2)OC)C)C |
| CAS | 161050584 |
| Splash | |
| Other Names |
Benzoic acid, 3-methoxy-2-methyl, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide; 3-Methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide; N'-(tert-Butyl )-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide |
| ChemSpider | 94755 |
| ChemIDPlus | 163442566; 161050584 |
| ChEMBL | CHEMBL55772 |
| ChEBI | CHEBI:38449 |
| PubChem | 105010 |
| KEGG | C18525 |
| Wikipedia | Methoxyfenozid (DE) |