Systematic / IUPAC Name: N-(2-Methoxyethyl)-3-[5-[(2S)-1-[(4-methylphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10712
Other Names: NAT18-429869
Formula: C22H27N5O2
N-(2-Methoxyethyl)-3-{5-[(2S)-1-(4-methylbenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1527 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 3:18:18 PM |
| InChI | InChI=1S/C22H27N5O2/c1-16-7-9-17(10-8-16)15-27-13-4-6-19(27)22-25-21(26-29-22)18-5-3-11-23-20(18)24-12-14-28-2/h3,5,7-11,19H,4,6,12-15H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChI Key | NMQGBENRRGHKSC-IBGZPJMESA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=C(N=CC=C4)NCCOC |
| CAS | |
| Splash | |
| Other Names | NAT18-429869 |