Systematic / IUPAC Name: (3R,4S)-3-Ethyl-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-phenylpiperidine-1-carboxamide
ID: Reference10714
Other Names: NAT14-323668
Formula: C21H27N3O3
(3R,4S)-3-Ethyl-4-{2-[(2-furylmethyl)amino]-2-oxoethyl}-N-phenyl-1-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1979 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 3:26:36 PM |
| InChI | InChI=1S/C21H27N3O3/c1-2-16-15-24(21(26)23-18-7-4-3-5-8-18)11-10-17(16)13-20(25)22-14-19-9-6-12-27-19/h3-9,12,16-17H,2,10-11,13-15H2,1H3,(H,22,25)(H,23,26)/t16-,17-/m0/s1 |
| InChI Key | HZZGNZJNUWLKQT-IRXDYDNUSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)NCC2=CC=CO2)C(=O)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT14-323668 |