Systematic / IUPAC Name: 5-[(2S)-1-Benzylpyrrolidin-2-yl]-3-(2-pyrrolidin-1-ylpyridin-4-yl)-1,2,4-oxadiazole
ID: Reference10722
Other Names: NAT18-473601
Formula: C22H25N5O
4-{5-[(2S)-1-Benzyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(1-pyrrolidinyl)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1085 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/6/2021 5:59:54 AM |
| InChI | InChI=1S/C22H25N5O/c1-2-7-17(8-3-1)16-27-14-6-9-19(27)22-24-21(25-28-22)18-10-11-23-20(15-18)26-12-4-5-13-26/h1-3,7-8,10-11,15,19H,4-6,9,12-14,16H2/t19-/m0/s1 |
| InChI Key | LIVYOJDPWSEUHC-IBGZPJMESA-N |
| Canonical SMILES | C1CCN(C1)C2=NC=CC(=C2)C3=NOC(=N3)C4CCCN4CC5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | NAT18-473601 |