Systematic / IUPAC Name: N-(2-Methoxyethyl)-3-[5-[(2S)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10732
Other Names: NAT18-429871
Formula: C24H31N5O5
N-(2-Methoxyethyl)-3-{5-[(2S)-1-(3,4,5-trimethoxybenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2559 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/12/2021 10:42:51 AM |
| InChI | InChI=1S/C24H31N5O5/c1-30-12-10-26-22-17(7-5-9-25-22)23-27-24(34-28-23)18-8-6-11-29(18)15-16-13-19(31-2)21(33-4)20(14-16)32-3/h5,7,9,13-14,18H,6,8,10-12,15H2,1-4H3,(H,25,26)/t18-/m0/s1 |
| InChI Key | GLCGGCKCOOSGEG-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC(=C(C(=C4)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names | NAT18-429871 |