Systematic / IUPAC Name: 3-(6-Imidazol-1-ylpyridin-3-yl)-5-[(2S)-1-[(1-methylindol-3-yl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10737
Other Names: NAT18-442357
Formula: C24H23N7O
3-{[(2S)-2-{3-[6-(1H-Imidazol-1-yl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-1-methyl-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 450 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/12/2021 11:39:15 AM |
| InChI | InChI=1S/C24H23N7O/c1-29-14-18(19-5-2-3-6-20(19)29)15-30-11-4-7-21(30)24-27-23(28-32-24)17-8-9-22(26-13-17)31-12-10-25-16-31/h2-3,5-6,8-10,12-14,16,21H,4,7,11,15H2,1H3/t21-/m0/s1 |
| InChI Key | GLULTRKAVJWAAH-NRFANRHFSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CN3CCCC3C4=NC(=NO4)C5=CN=C(C=C5)N6C=CN=C6 |
| CAS | |
| Splash | |
| Other Names | NAT18-442357 |