Systematic / IUPAC Name: [(2,6-Dimethylphenyl)(1H-pyrazol-1-ylmethyl)carbamoyl]formic acid
ID: Reference1074
Other Names:
Acetic acid, 2-[(2,6-dimethylphenyl)(1H-pyrazol-1-ylmethyl)amino]-2-oxo-;
N-(2,6-Dimethyl-phenyl)-N-pyrazol-1-ylmethyl-oxalamic acid;
2-[2,6-Dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxo-acetic acid
Formula: C14H15N3O3
Class: Pesticides/Herbicides
Metazachlor OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 37 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 3:43:13 PM |
| InChI | InChI=1S/C14H15N3O3/c1-10-5-3-6-11(2)12(10)17(13(18)14(19)20)9-16-8-4-7-15-16/h3-8H,9H2,1-2H3,(H,19,20) |
| InChI Key | PHMHHVKFXZNTKU-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C)N(CN2C=CC=N2)C(=O)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
Acetic acid, 2-[(2,6-dimethylphenyl)(1H-pyrazol-1-ylmethyl)amino]-2-oxo-; N-(2,6-Dimethyl-phenyl)-N-pyrazol-1-ylmethyl-oxalamic acid; 2-[2,6-Dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxo-acetic acid |
| ChemSpider | 24721983 |