Systematic / IUPAC Name: 3-[[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl]-N-[(3-methoxyphenyl)methyl]oxetan-3-amine
ID: Reference10746
Other Names: NAT39-500093
Formula: C21H21FN2O3
3-{[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl}-N-(3-methoxybenzyl)-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1635 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/13/2021 5:49:41 AM |
| InChI | InChI=1S/C21H21FN2O3/c1-25-19-4-2-3-15(9-19)12-23-21(13-26-14-21)11-18-10-20(27-24-18)16-5-7-17(22)8-6-16/h2-10,23H,11-14H2,1H3 |
| InChI Key | BKYYQZLUJMFNIA-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)CNC2(COC2)CC3=NOC(=C3)C4=CC=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names | NAT39-500093 |