Systematic / IUPAC Name: N,N-Diethyl-3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]oxetan-3-amine
ID: Reference10747
Other Names: NAT39-500164
Formula: C13H22N2O3
N,N-Diethyl-3-{[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl}-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 370 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/13/2021 5:50:37 AM |
| InChI | InChI=1S/C13H22N2O3/c1-4-15(5-2)13(9-17-10-13)7-11-6-12(8-16-3)18-14-11/h6H,4-5,7-10H2,1-3H3 |
| InChI Key | YVEVUBFPHDOVSB-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)C1(COC1)CC2=NOC(=C2)COC |
| CAS | |
| Splash | |
| Other Names | NAT39-500164 |
| PubChem | 56775530 |
| ChemSpider | 29853498 |
| ChEMBL | CHEMBL3437332 |