Systematic / IUPAC Name: N-[3-[[5-(Methoxymethyl)-1,2-oxazol-3-yl]methyl]oxetan-3-yl]-1-methylpiperidin-4-amine
ID: Reference10748
Other Names: NAT39-500194
Formula: C15H25N3O3
N-(3-{[5-(Methoxymethyl)-1,2-oxazol-3-yl]methyl}-3-oxetanyl)-1-methyl-4-piperidinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 430 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/13/2021 5:52:22 AM |
| InChI | InChI=1S/C15H25N3O3/c1-18-5-3-12(4-6-18)16-15(10-20-11-15)8-13-7-14(9-19-2)21-17-13/h7,12,16H,3-6,8-11H2,1-2H3 |
| InChI Key | QZOPSNCLCAJFGW-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCC(CC1)NC2(COC2)CC3=NOC(=C3)COC |
| CAS | |
| Splash | |
| Other Names | NAT39-500194 |
| PubChem | 56775549 |
| ChEMBL | CHEMBL3436895 |
| ChemSpider | 29853517 |