Systematic / IUPAC Name: 2-[(2,6-Dimethylphenyl)(2-methoxyethyl)amino]-2-oxoethanesulfonic acid
ID: Reference1075
Other Names: Ethanesulfonic acid, 2-[(2,6-dimethylphenyl)(2-methoxyethyl)amino]-2-oxo-
Formula: C13H19NO5S
Class: Pesticides/Herbicides
Dimethachlor ESA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 121 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 12:22:03 PM |
| InChI | InChI=1S/C13H19NO5S/c1-10-5-4-6-11(2)13(10)14(7-8-19-3)12(15)9-20(16,17)18/h4-6H,7-9H2,1-3H3,(H,16,17,18) |
| InChI Key | RVSCDWJKJDBFRS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C)N(CCOC)C(=O)CS(=O)(=O)O |
| CAS | |
| Splash | |
| Other Names | Ethanesulfonic acid, 2-[(2,6-dimethylphenyl)(2-methoxyethyl)amino]-2-oxo- |
| ChemSpider | 28290251 |
| ChEBI | CHEBI:83484 |
| PubChem | 86290104 |