Systematic / IUPAC Name: N-[4-[(R)-[(3R)-4-Benzyl-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]benzamide
ID: Reference10752
Other Names: NAT36-504330
Formula: C25H24N2O4
N-{4-[(R)-[(3R)-4-Benzyl-5-oxo-3-morpholinyl](hydroxy)methyl]phenyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2780 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/13/2021 5:56:27 AM |
| InChI | InChI=1S/C25H24N2O4/c28-23-17-31-16-22(27(23)15-18-7-3-1-4-8-18)24(29)19-11-13-21(14-12-19)26-25(30)20-9-5-2-6-10-20/h1-14,22,24,29H,15-17H2,(H,26,30)/t22-,24-/m1/s1 |
| InChI Key | AOKLCKVANSXEOI-ISKFKSNPSA-N |
| Canonical SMILES | C1C(N(C(=O)CO1)CC2=CC=CC=C2)C(C3=CC=C(C=C3)NC(=O)C4=CC=CC=C4)O |
| CAS | |
| Splash | |
| Other Names | NAT36-504330 |