Systematic / IUPAC Name: 3-(6-Methoxypyridin-3-yl)-5-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10759
Other Names:
Pyridine, 2-methoxy-5-[5-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-;
NAT18-443208
Formula: C20H19F3N4O2
2-Methoxy-5-(5-{(2S)-1-[4-(trifluoromethyl)benzyl]-2-pyrrolidinyl}-1,2,4-oxadiazol-3-yl)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1607 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/19/2021 1:56:47 PM |
| InChI | InChI=1S/C20H19F3N4O2/c1-28-17-9-6-14(11-24-17)18-25-19(29-26-18)16-3-2-10-27(16)12-13-4-7-15(8-5-13)20(21,22)23/h4-9,11,16H,2-3,10,12H2,1H3/t16-/m0/s1 |
| InChI Key | SFKCFRGLOVIRNB-INIZCTEOSA-N |
| Canonical SMILES | COC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=C(C=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 2-methoxy-5-[5-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-; NAT18-443208 |