Systematic / IUPAC Name: 3-[6-(2-Methoxyethoxy)pyridin-3-yl]-5-[(2S)-1-propan-2-ylpyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference10766
Other Names:
Pyridine, 2-(2-methoxyethoxy)-5-[5-[(2S)-1-(1-methylethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-;
NAT18-432665
Formula: C17H24N4O3
5-{5-[(2S)-1-Isopropyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/19/2021 2:18:56 PM |
| InChI | InChI=1S/C17H24N4O3/c1-12(2)21-8-4-5-14(21)17-19-16(20-24-17)13-6-7-15(18-11-13)23-10-9-22-3/h6-7,11-12,14H,4-5,8-10H2,1-3H3/t14-/m0/s1 |
| InChI Key | MMWQTMOYRXPRGT-AWEZNQCLSA-N |
| Canonical SMILES | CC(C)N1CCCC1C2=NC(=NO2)C3=CN=C(C=C3)OCCOC |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 2-(2-methoxyethoxy)-5-[5-[(2S)-1-(1-methylethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-; NAT18-432665 |