Systematic / IUPAC Name: 2-[(2,4-Dimethyl-3-thienyl)(1-methoxy-2-propanyl)amino]-2-oxoethanesulfonic acid
ID: Reference1077
Other Names: Ethanesulfonic acid, 2-[(2,4-dimethyl-3-thienyl)(2-methoxy-1-methylethyl)amino]-2-oxo-
Formula: C12H19NO5S2
Class: Pesticides/Herbicides
Dimethenamid ESA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 106 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 3:50:14 PM |
| InChI | InChI=1S/C12H19NO5S2/c1-8-6-19-10(3)12(8)13(9(2)5-18-4)11(14)7-20(15,16)17/h6,9H,5,7H2,1-4H3,(H,15,16,17) |
| InChI Key | YMYKMSAZEZQEER-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC(=C1N(C(C)COC)C(=O)CS(=O)(=O)O)C |
| CAS | 205939588 |
| Splash | |
| Other Names | Ethanesulfonic acid, 2-[(2,4-dimethyl-3-thienyl)(2-methoxy-1-methylethyl)amino]-2-oxo- |