Systematic / IUPAC Name: 3-[5-[(2S)-1-Benzylpyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]-N-(2-methoxyethyl)pyridin-2-amine
ID: Reference10771
Other Names: NAT18-429833
Formula: C21H25N5O2
3-{5-[(2S)-1-Benzyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-N-(2-methoxyethyl)-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 425 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/19/2021 2:29:37 PM |
| InChI | InChI=1S/C21H25N5O2/c1-27-14-12-23-19-17(9-5-11-22-19)20-24-21(28-25-20)18-10-6-13-26(18)15-16-7-3-2-4-8-16/h2-5,7-9,11,18H,6,10,12-15H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChI Key | BJFITXVNBYYRLJ-SFHVURJKSA-N |
| Canonical SMILES | COCCNC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT18-429833 |