Systematic / IUPAC Name: N-(2-Methoxyethyl)-3-[5-[(2S)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-amine
ID: Reference10772
Other Names: NAT18-429867
Formula: C19H23N5O2S
N-(2-Methoxyethyl)-3-{5-[(2S)-1-(2-thienylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/19/2021 2:31:48 PM |
| InChI | InChI=1S/C19H23N5O2S/c1-25-11-9-21-17-15(6-2-8-20-17)18-22-19(26-23-18)16-7-3-10-24(16)13-14-5-4-12-27-14/h2,4-6,8,12,16H,3,7,9-11,13H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChI Key | LYNMIVXXJSJHCL-INIZCTEOSA-N |
| Canonical SMILES | COCCNC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | NAT18-429867 |