Systematic / IUPAC Name: 1-[4-[(R)-[(3R)-4-(Cyclohexylmethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-3-ethylurea
ID: Reference10775
Other Names:
Urea, N-[4-[(R)-[(3R)-4-(cyclohexylmethyl)-5-oxo-3-morpholinyl]hydroxymethyl]phenyl]-N'-ethyl-;
NAT36-504425
Formula: C21H31N3O4
1-{4-[(R)-[(3R)-4-(Cyclohexylmethyl)-5-oxo-3-morpholinyl](hydroxy)methyl]phenyl}-3-ethylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2985 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2021 8:04:39 AM |
| InChI | InChI=1S/C21H31N3O4/c1-2-22-21(27)23-17-10-8-16(9-11-17)20(26)18-13-28-14-19(25)24(18)12-15-6-4-3-5-7-15/h8-11,15,18,20,26H,2-7,12-14H2,1H3,(H2,22,23,27)/t18-,20-/m1/s1 |
| InChI Key | LPFKRESSBCQQIJ-UYAOXDASSA-N |
| Canonical SMILES | CCNC(=O)NC1=CC=C(C=C1)C(C2COCC(=O)N2CC3CCCCC3)O |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[4-[(R)-[(3R)-4-(cyclohexylmethyl)-5-oxo-3-morpholinyl]hydroxymethyl]phenyl]-N'-ethyl-; NAT36-504425 |