Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-(2-methylpropyl)-5-oxomorpholin-3-yl]methyl]phenyl]benzamide
ID: Reference10776
Other Names: NAT36-504730
Formula: C22H26N2O4
N-(4-{(R)-Hydroxy[(3R)-4-isobutyl-5-oxo-3-morpholinyl]methyl}phenyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2514 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2021 8:05:35 AM |
| InChI | InChI=1S/C22H26N2O4/c1-15(2)12-24-19(13-28-14-20(24)25)21(26)16-8-10-18(11-9-16)23-22(27)17-6-4-3-5-7-17/h3-11,15,19,21,26H,12-14H2,1-2H3,(H,23,27)/t19-,21-/m1/s1 |
| InChI Key | VCNYDNKATJJGOJ-TZIWHRDSSA-N |
| Canonical SMILES | CC(C)CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3)O |
| CAS | |
| Splash | |
| Other Names | NAT36-504730 |