Systematic / IUPAC Name: [(2,4-Dimethyl-3-thienyl)(1-methoxy-2-propanyl)amino](oxo)acetic acid
ID: Reference1078
Other Names:
[(2,4-Dimethylthiophen-3-yl)(1-methoxypropan-2-yl)amino](oxo)acetic acid;
Acetic acid, 2-[(2,4-dimethyl-3-thienyl)(2-methoxy-1-methylethyl)amino]-2-oxo-
Formula: C12H17NO4S
Class: Pesticides/Herbicides
Dimethenamide OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 136 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 12:28:35 PM |
| InChI | InChI=1S/C12H17NO4S/c1-7-6-18-9(3)10(7)13(8(2)5-17-4)11(14)12(15)16/h6,8H,5H2,1-4H3,(H,15,16) |
| InChI Key | HOYCASTVMCEOTP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC(=C1N(C(C)COC)C(=O)C(=O)O)C |
| CAS | 380412599 |
| Splash | |
| Other Names |
[(2,4-Dimethylthiophen-3-yl)(1-methoxypropan-2-yl)amino](oxo)acetic acid; Acetic acid, 2-[(2,4-dimethyl-3-thienyl)(2-methoxy-1-methylethyl)amino]-2-oxo- |