Systematic / IUPAC Name: 1-[(1S,3S)-2,2-Dimethyl-3-[[5-(morpholin-4-ylmethyl)-1,2-oxazol-3-yl]methyl]cyclobutyl]-3-propan-2-ylurea
ID: Reference10783
Other Names:
Urea, N-[(1S,3S)-2,2-dimethyl-3-[[5-(4-morpholinylmethyl)-3-isoxazolyl]methyl]cyclobutyl]-N'-(1-methylethyl)-;
NAT26-504084
Formula: C19H32N4O3
1-[(1S,3S)-2,2-Dimethyl-3-{[5-(4-morpholinylmethyl)-1,2-oxazol-3-yl]methyl}cyclobutyl]-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1124 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2021 8:17:46 AM |
| InChI | InChI=1S/C19H32N4O3/c1-13(2)20-18(24)21-17-10-14(19(17,3)4)9-15-11-16(26-22-15)12-23-5-7-25-8-6-23/h11,13-14,17H,5-10,12H2,1-4H3,(H2,20,21,24)/t14-,17+/m1/s1 |
| InChI Key | LJBPPWAMRLJPPM-PBHICJAKSA-N |
| Canonical SMILES | CC(C)NC(=O)NC1CC(C1(C)C)CC2=NOC(=C2)CN3CCOCC3 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1S,3S)-2,2-dimethyl-3-[[5-(4-morpholinylmethyl)-3-isoxazolyl]methyl]cyclobutyl]-N'-(1-methylethyl)-; NAT26-504084 |
| PubChem | 56774213 |
| ChemSpider | 29849115 |
| ChEMBL | CHEMBL3437128 |