Systematic / IUPAC Name: N-[4-[(R)-[(3R)-4-(2-Ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]cyclopentanecarboxamide
ID: Reference10793
Other Names: NAT36-509594
Formula: C21H30N2O5
N-{4-[(R)-[(3R)-4-(2-Ethoxyethyl)-5-oxo-3-morpholinyl](hydroxy)methyl]phenyl}cyclopentanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2655 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2021 7:25:19 AM |
| InChI | InChI=1S/C21H30N2O5/c1-2-27-12-11-23-18(13-28-14-19(23)24)20(25)15-7-9-17(10-8-15)22-21(26)16-5-3-4-6-16/h7-10,16,18,20,25H,2-6,11-14H2,1H3,(H,22,26)/t18-,20-/m1/s1 |
| InChI Key | GUZXZHOUXPKACP-UYAOXDASSA-N |
| Canonical SMILES | CCOCCN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)C3CCCC3)O |
| CAS | |
| Splash | |
| Other Names | NAT36-509594 |